C23H24N4O3S2 — CID 17322002
N-[5-[2-(3-methylphenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 17322002) has the molecular formula C23H24N4O3S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[5-[2-(3-methylphenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[5-[2-(3-methylphenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17322002 |
| Molecular Formula | C23H24N4O3S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-[5-[2-(3-methylphenoxy)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cccc(OCCSc2nnc(NC(=O)C3CC(=O)N(c4cccc(C)c4)C3)s2)c1 |
| InChI | InChI=1S/C23H24N4O3S2/c1-15-5-3-7-18(11-15)27-14-17(13-20(27)28)21(29)24-22-25-26-23(32-22)31-10-9-30-19-8-4-6-16(2)12-19/h3-8,11-12,17H,9-10,13-14H2,1-2H3,(H,24,25,29) |
| InChIKey | LNSYTRISIVVBFL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|