C24H21N5O4S2 — CID 17321976
N-[5-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 17321976) has the molecular formula C24H21N5O4S2 and a molecular weight of 507.60 g/mol. Its IUPAC name is N-[5-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17321976 |
| Molecular Formula | C24H21N5O4S2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cccc(N2CC(C(=O)Nc3nnc(SCCN4C(=O)c5ccccc5C4=O)s3)CC2=O)c1 |
| InChI | InChI=1S/C24H21N5O4S2/c1-14-5-4-6-16(11-14)29-13-15(12-19(29)30)20(31)25-23-26-27-24(35-23)34-10-9-28-21(32)17-7-2-3-8-18(17)22(28)33/h2-8,11,15H,9-10,12-13H2,1H3,(H,25,26,31) |
| InChIKey | CBUYSOBXSSGIRC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|