C23H24N4O2S2 — CID 17321540
1-(4-methylphenyl)-5-oxo-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 17321540) has the molecular formula C23H24N4O2S2 and a molecular weight of 452.61 g/mol. Its IUPAC name is 1-(4-methylphenyl)-5-oxo-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)-5-oxo-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17321540 |
| Molecular Formula | C23H24N4O2S2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 1-(4-methylphenyl)-5-oxo-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)Nc3nnc(SCCCc4ccccc4)s3)CC2=O)cc1 |
| InChI | InChI=1S/C23H24N4O2S2/c1-16-9-11-19(12-10-16)27-15-18(14-20(27)28)21(29)24-22-25-26-23(31-22)30-13-5-8-17-6-3-2-4-7-17/h2-4,6-7,9-12,18H,5,8,13-15H2,1H3,(H,24,25,29) |
| InChIKey | XWGXEVBIGIUIIC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|