C15H13N5O2S2 — CID 7483326
(3S)-N-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 7483326) has the molecular formula C15H13N5O2S2 and a molecular weight of 359.44 g/mol. Its IUPAC name is (3S)-N-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7483326 |
| Molecular Formula | C15H13N5O2S2 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (3S)-N-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | N#CCSc1nnc(NC(=O)[C@H]2CC(=O)N(c3ccccc3)C2)s1 |
| InChI | InChI=1S/C15H13N5O2S2/c16-6-7-23-15-19-18-14(24-15)17-13(22)10-8-12(21)20(9-10)11-4-2-1-3-5-11/h1-5,10H,7-9H2,(H,17,18,22)/t10-/m0/s1 |
| InChIKey | AGXRJHDKNXLARP-JTQLQIEISA-N |
| XLogP | 2.15 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|