C21H17ClN4O3S2 — CID 17308367
N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 17308367) has the molecular formula C21H17ClN4O3S2 and a molecular weight of 472.98 g/mol. Its IUPAC name is N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17308367 |
| Molecular Formula | C21H17ClN4O3S2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | N-[5-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)C2CC(=O)N(c3ccccc3)C2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClN4O3S2/c22-15-8-6-13(7-9-15)17(27)12-30-21-25-24-20(31-21)23-19(29)14-10-18(28)26(11-14)16-4-2-1-3-5-16/h1-9,14H,10-12H2,(H,23,24,29) |
| InChIKey | IVMDKDQGIKLBJD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|