C22H18Cl2N4O4S2 — CID 17322015
N-[5-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 17322015) has the molecular formula C22H18Cl2N4O4S2 and a molecular weight of 537.45 g/mol. Its IUPAC name is N-[5-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[5-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17322015 |
| Molecular Formula | C22H18Cl2N4O4S2 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | N-[5-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2CC(C(=O)Nc3nnc(SCC(=O)c4ccc(Cl)cc4Cl)s3)CC2=O)cc1 |
| InChI | InChI=1S/C22H18Cl2N4O4S2/c1-32-15-5-3-14(4-6-15)28-10-12(8-19(28)30)20(31)25-21-26-27-22(34-21)33-11-18(29)16-7-2-13(23)9-17(16)24/h2-7,9,12H,8,10-11H2,1H3,(H,25,26,31) |
| InChIKey | SQMUCHVVJVUSHV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|