C20H19N5O3S2 — CID 40834154
(3R)-1-(4-methoxyphenyl)-5-oxo-N-[5-(pyridin-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 40834154) has the molecular formula C20H19N5O3S2 and a molecular weight of 441.54 g/mol. Its IUPAC name is (3R)-1-(4-methoxyphenyl)-5-oxo-N-[5-(pyridin-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-methoxyphenyl)-5-oxo-N-[5-(pyridin-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 40834154 |
| Molecular Formula | C20H19N5O3S2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | (3R)-1-(4-methoxyphenyl)-5-oxo-N-[5-(pyridin-3-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2C[C@H](C(=O)Nc3nnc(SCc4cccnc4)s3)CC2=O)cc1 |
| InChI | InChI=1S/C20H19N5O3S2/c1-28-16-6-4-15(5-7-16)25-11-14(9-17(25)26)18(27)22-19-23-24-20(30-19)29-12-13-3-2-8-21-10-13/h2-8,10,14H,9,11-12H2,1H3,(H,22,23,27)/t14-/m1/s1 |
| InChIKey | LKYRTOXYZCAVSU-CQSZACIVSA-N |
| XLogP | 3.23 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|