C22H18Cl3N5O3S2 — CID 17308382
1-(4-chlorophenyl)-N-[5-[3-(3,4-dichloroanilino)-3-oxopropyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 17308382) has the molecular formula C22H18Cl3N5O3S2 and a molecular weight of 570.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[5-[3-(3,4-dichloroanilino)-3-oxopropyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[5-[3-(3,4-dichloroanilino)-3-oxopropyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17308382 |
| Molecular Formula | C22H18Cl3N5O3S2 |
| Molecular Weight | 570.91 g/mol |
| Exact Mass | 568.99 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[5-[3-(3,4-dichloroanilino)-3-oxopropyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(CCSc1nnc(NC(=O)C2CC(=O)N(c3ccc(Cl)cc3)C2)s1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl3N5O3S2/c23-13-1-4-15(5-2-13)30-11-12(9-19(30)32)20(33)27-21-28-29-22(35-21)34-8-7-18(31)26-14-3-6-16(24)17(25)10-14/h1-6,10,12H,7-9,11H2,(H,26,31)(H,27,28,33) |
| InChIKey | CYIHMMGAZVCPDW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.91 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|