C15H12FN5O2S2 — CID 7483887
(3S)-N-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 7483887) has the molecular formula C15H12FN5O2S2 and a molecular weight of 377.43 g/mol. Its IUPAC name is (3S)-N-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7483887 |
| Molecular Formula | C15H12FN5O2S2 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (3S)-N-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | N#CCSc1nnc(NC(=O)[C@H]2CC(=O)N(c3ccc(F)cc3)C2)s1 |
| InChI | InChI=1S/C15H12FN5O2S2/c16-10-1-3-11(4-2-10)21-8-9(7-12(21)22)13(23)18-14-19-20-15(25-14)24-6-5-17/h1-4,9H,6-8H2,(H,18,19,23)/t9-/m0/s1 |
| InChIKey | HABSCTXTVUIFRS-VIFPVBQESA-N |
| XLogP | 2.28 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|