C17H18N4O4S2 — CID 7483571
(2S)-2-[[5-[[(3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid (PubChem CID 7483571) has the molecular formula C17H18N4O4S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (2S)-2-[[5-[[(3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | (2S)-2-[[5-[[(3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 7483571 |
| Molecular Formula | C17H18N4O4S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (2S)-2-[[5-[[(3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoic acid |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)Nc3nnc(S[C@@H](C)C(=O)O)s3)CC2=O)cc1 |
| InChI | InChI=1S/C17H18N4O4S2/c1-9-3-5-12(6-4-9)21-8-11(7-13(21)22)14(23)18-16-19-20-17(27-16)26-10(2)15(24)25/h3-6,10-11H,7-8H2,1-2H3,(H,24,25)(H,18,19,23)/t10-,11-/m0/s1 |
| InChIKey | JVPQEEQCTUYLKZ-QWRGUYRKSA-N |
| XLogP | 2.40 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|