C17H17N4O4S2- — CID 7483371
(2S)-2-[[5-[[(3R)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate (PubChem CID 7483371) has the molecular formula C17H17N4O4S2- and a molecular weight of 405.48 g/mol. Its IUPAC name is (2S)-2-[[5-[[(3R)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate.
| Compound Name | (2S)-2-[[5-[[(3R)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 7483371 |
| Molecular Formula | C17H17N4O4S2- |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (2S)-2-[[5-[[(3R)-1-(2-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanoate |
| SMILES | Cc1ccccc1N1C[C@H](C(=O)Nc2nnc(S[C@@H](C)C(=O)[O-])s2)CC1=O |
| InChI | InChI=1S/C17H18N4O4S2/c1-9-5-3-4-6-12(9)21-8-11(7-13(21)22)14(23)18-16-19-20-17(27-16)26-10(2)15(24)25/h3-6,10-11H,7-8H2,1-2H3,(H,24,25)(H,18,19,23)/p-1/t10-,11+/m0/s1 |
| InChIKey | GYCRVYHZVAPNBQ-WDEREUQCSA-M |
| XLogP | 1.07 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|