C19H21N5O4S2 — CID 41105908
(3R)-N-[5-[(2S)-1-(dimethylamino)-1,3-dioxobutan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 41105908) has the molecular formula C19H21N5O4S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is (3R)-N-[5-[(2S)-1-(dimethylamino)-1,3-dioxobutan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[5-[(2S)-1-(dimethylamino)-1,3-dioxobutan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 41105908 |
| Molecular Formula | C19H21N5O4S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (3R)-N-[5-[(2S)-1-(dimethylamino)-1,3-dioxobutan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CC(=O)[C@H](Sc1nnc(NC(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)s1)C(=O)N(C)C |
| InChI | InChI=1S/C19H21N5O4S2/c1-11(25)15(17(28)23(2)3)29-19-22-21-18(30-19)20-16(27)12-9-14(26)24(10-12)13-7-5-4-6-8-13/h4-8,12,15H,9-10H2,1-3H3,(H,20,21,27)/t12-,15+/m1/s1 |
| InChIKey | DOBNIOSHOVIGDV-DOMZBBRYSA-N |
| XLogP | 1.67 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|