C22H28N4O2S2 — CID 17321668
1-cyclohexyl-5-oxo-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 17321668) has the molecular formula C22H28N4O2S2 and a molecular weight of 444.63 g/mol. Its IUPAC name is 1-cyclohexyl-5-oxo-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-cyclohexyl-5-oxo-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17321668 |
| Molecular Formula | C22H28N4O2S2 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-cyclohexyl-5-oxo-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCCCc2ccccc2)s1)C1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C22H28N4O2S2/c27-19-14-17(15-26(19)18-11-5-2-6-12-18)20(28)23-21-24-25-22(30-21)29-13-7-10-16-8-3-1-4-9-16/h1,3-4,8-9,17-18H,2,5-7,10-15H2,(H,23,24,28) |
| InChIKey | AUMKDFQXJTXORK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|