C19H17FN4O2S3 — CID 146086495
1-(3-fluoro-4-methylphenyl)-5-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 146086495) has the molecular formula C19H17FN4O2S3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-5-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-5-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 146086495 |
| Molecular Formula | C19H17FN4O2S3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-5-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)Nc3nnc(SCc4cccs4)s3)CC2=O)cc1F |
| InChI | InChI=1S/C19H17FN4O2S3/c1-11-4-5-13(8-15(11)20)24-9-12(7-16(24)25)17(26)21-18-22-23-19(29-18)28-10-14-3-2-6-27-14/h2-6,8,12H,7,9-10H2,1H3,(H,21,22,26) |
| InChIKey | WHUHXDKYASIRSG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|