C22H23FN4OS2 — CID 133160665
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 133160665) has the molecular formula C22H23FN4OS2 and a molecular weight of 442.59 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133160665 |
| Molecular Formula | C22H23FN4OS2 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)C1CCCN(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H23FN4OS2/c23-19-10-8-16(9-11-19)13-27-12-4-7-18(14-27)20(28)24-21-25-26-22(30-21)29-15-17-5-2-1-3-6-17/h1-3,5-6,8-11,18H,4,7,12-15H2,(H,24,25,28) |
| InChIKey | VWSAVAOOGVUONT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|