C21H21FN4O3S3 — CID 2541605
1-(benzenesulfonyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 2541605) has the molecular formula C21H21FN4O3S3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 2541605 |
| Molecular Formula | C21H21FN4O3S3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccc(F)cc2)s1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H21FN4O3S3/c22-17-8-6-15(7-9-17)14-30-21-25-24-20(31-21)23-19(27)16-10-12-26(13-11-16)32(28,29)18-4-2-1-3-5-18/h1-9,16H,10-14H2,(H,23,24,27) |
| InChIKey | WQLQOSHQXACWHS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|