C17H21FN4O3S3 — CID 100690342
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(4-fluorophenyl)methylsulfonyl]piperidine-4-carboxamide (PubChem CID 100690342) has the molecular formula C17H21FN4O3S3 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(4-fluorophenyl)methylsulfonyl]piperidine-4-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(4-fluorophenyl)methylsulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100690342 |
| Molecular Formula | C17H21FN4O3S3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(4-fluorophenyl)methylsulfonyl]piperidine-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)C2CCN(S(=O)(=O)Cc3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C17H21FN4O3S3/c1-2-26-17-21-20-16(27-17)19-15(23)13-7-9-22(10-8-13)28(24,25)11-12-3-5-14(18)6-4-12/h3-6,13H,2,7-11H2,1H3,(H,19,20,23) |
| InChIKey | TZPRKCRPYLUMKZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|