C22H23BrN4O3S3 — CID 100685419
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(3-bromophenyl)methylsulfonyl]piperidine-4-carboxamide (PubChem CID 100685419) has the molecular formula C22H23BrN4O3S3 and a molecular weight of 567.56 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(3-bromophenyl)methylsulfonyl]piperidine-4-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(3-bromophenyl)methylsulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100685419 |
| Molecular Formula | C22H23BrN4O3S3 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(3-bromophenyl)methylsulfonyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)C1CCN(S(=O)(=O)Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C22H23BrN4O3S3/c23-19-8-4-7-17(13-19)15-33(29,30)27-11-9-18(10-12-27)20(28)24-21-25-26-22(32-21)31-14-16-5-2-1-3-6-16/h1-8,13,18H,9-12,14-15H2,(H,24,25,28) |
| InChIKey | LIJZJVGTBBMZFF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|