C16H18F2N4O3S3 — CID 121029141
N-[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 121029141) has the molecular formula C16H18F2N4O3S3 and a molecular weight of 448.54 g/mol. Its IUPAC name is N-[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 121029141 |
| Molecular Formula | C16H18F2N4O3S3 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | N-[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Nc2nnc(SCc3ccc(F)c(F)c3)s2)CC1 |
| InChI | InChI=1S/C16H18F2N4O3S3/c1-28(24,25)22-6-4-11(5-7-22)14(23)19-15-20-21-16(27-15)26-9-10-2-3-12(17)13(18)8-10/h2-3,8,11H,4-7,9H2,1H3,(H,19,20,23) |
| InChIKey | UBCGVFSEEBIQDL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|