C12H16N4O3S3 — CID 121029041
1-methylsulfonyl-N-(5-prop-2-ynylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 121029041) has the molecular formula C12H16N4O3S3 and a molecular weight of 360.49 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(5-prop-2-ynylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-methylsulfonyl-N-(5-prop-2-ynylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121029041 |
| Molecular Formula | C12H16N4O3S3 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 1-methylsulfonyl-N-(5-prop-2-ynylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | C#CCSc1nnc(NC(=O)C2CCN(S(C)(=O)=O)CC2)s1 |
| InChI | InChI=1S/C12H16N4O3S3/c1-3-8-20-12-15-14-11(21-12)13-10(17)9-4-6-16(7-5-9)22(2,18)19/h1,9H,4-8H2,2H3,(H,13,14,17) |
| InChIKey | DQDPYCYMCZFFDK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|