C12H17N5O3S3 — CID 121029136
N-[5-(2-cyanoethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 121029136) has the molecular formula C12H17N5O3S3 and a molecular weight of 375.50 g/mol. Its IUPAC name is N-[5-(2-cyanoethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[5-(2-cyanoethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 121029136 |
| Molecular Formula | C12H17N5O3S3 |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[5-(2-cyanoethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Nc2nnc(SCCC#N)s2)CC1 |
| InChI | InChI=1S/C12H17N5O3S3/c1-23(19,20)17-6-3-9(4-7-17)10(18)14-11-15-16-12(22-11)21-8-2-5-13/h9H,2-4,6-8H2,1H3,(H,14,15,18) |
| InChIKey | VPYKFEQYBGKEQJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|