C18H22N4O5S3 — CID 121029138
N-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 121029138) has the molecular formula C18H22N4O5S3 and a molecular weight of 470.60 g/mol. Its IUPAC name is N-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 121029138 |
| Molecular Formula | C18H22N4O5S3 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(C(=O)CSc2nnc(NC(=O)C3CCN(S(C)(=O)=O)CC3)s2)cc1 |
| InChI | InChI=1S/C18H22N4O5S3/c1-27-14-5-3-12(4-6-14)15(23)11-28-18-21-20-17(29-18)19-16(24)13-7-9-22(10-8-13)30(2,25)26/h3-6,13H,7-11H2,1-2H3,(H,19,20,24) |
| InChIKey | QBVUMVUDNLWLQC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|