C16H19N5O5S3 — CID 121029125
1-methylsulfonyl-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 121029125) has the molecular formula C16H19N5O5S3 and a molecular weight of 457.56 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121029125 |
| Molecular Formula | C16H19N5O5S3 |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 1-methylsulfonyl-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Nc2nnc(SCc3ccc([N+](=O)[O-])cc3)s2)CC1 |
| InChI | InChI=1S/C16H19N5O5S3/c1-29(25,26)20-8-6-12(7-9-20)14(22)17-15-18-19-16(28-15)27-10-11-2-4-13(5-3-11)21(23)24/h2-5,12H,6-10H2,1H3,(H,17,18,22) |
| InChIKey | XREVUZXFGLMDAL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|