C13H15N5O5S3 — CID 121029665
2-[methyl(methylsulfonyl)amino]-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 121029665) has the molecular formula C13H15N5O5S3 and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[methyl(methylsulfonyl)amino]-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[methyl(methylsulfonyl)amino]-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 121029665 |
| Molecular Formula | C13H15N5O5S3 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 2-[methyl(methylsulfonyl)amino]-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CN(CC(=O)Nc1nnc(SCc2ccc([N+](=O)[O-])cc2)s1)S(C)(=O)=O |
| InChI | InChI=1S/C13H15N5O5S3/c1-17(26(2,22)23)7-11(19)14-12-15-16-13(25-12)24-8-9-3-5-10(6-4-9)18(20)21/h3-6H,7-8H2,1-2H3,(H,14,15,19) |
| InChIKey | HSDXLVNSFHKMKF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|