C8H13N5O4S3 — CID 121029593
N-[5-(2-amino-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]-2-[methyl(methylsulfonyl)amino]acetamide (PubChem CID 121029593) has the molecular formula C8H13N5O4S3 and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[5-(2-amino-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]-2-[methyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-[5-(2-amino-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]-2-[methyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 121029593 |
| Molecular Formula | C8H13N5O4S3 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-[5-(2-amino-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]-2-[methyl(methylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1nnc(SCC(N)=O)s1)S(C)(=O)=O |
| InChI | InChI=1S/C8H13N5O4S3/c1-13(20(2,16)17)3-6(15)10-7-11-12-8(19-7)18-4-5(9)14/h3-4H2,1-2H3,(H2,9,14)(H,10,11,15) |
| InChIKey | RURILLYCLOKKCN-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|