C17H21N5O6S3 — CID 121029628
ethyl 2-[[2-[[5-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 121029628) has the molecular formula C17H21N5O6S3 and a molecular weight of 487.59 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[[5-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 121029628 |
| Molecular Formula | C17H21N5O6S3 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | ethyl 2-[[2-[[5-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CSc1nnc(NC(=O)CN(C)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C17H21N5O6S3/c1-4-28-15(25)11-7-5-6-8-12(11)18-14(24)10-29-17-21-20-16(30-17)19-13(23)9-22(2)31(3,26)27/h5-8H,4,9-10H2,1-3H3,(H,18,24)(H,19,20,23) |
| InChIKey | HEYBONUAFGPIJS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|