C21H20N4O4S2 — CID 42448147
ethyl 2-[[2-[[5-[(3-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 42448147) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(3-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[[5-[(3-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 42448147 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | ethyl 2-[[2-[[5-[(3-methylbenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CSc1nnc(NC(=O)c2cccc(C)c2)s1 |
| InChI | InChI=1S/C21H20N4O4S2/c1-3-29-19(28)15-9-4-5-10-16(15)22-17(26)12-30-21-25-24-20(31-21)23-18(27)14-8-6-7-13(2)11-14/h4-11H,3,12H2,1-2H3,(H,22,26)(H,23,24,27) |
| InChIKey | YOFRBPDBBQFWFX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|