C15H14N6O2S3 — CID 3290505
3-methyl-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 3290505) has the molecular formula C15H14N6O2S3 and a molecular weight of 406.52 g/mol. Its IUPAC name is 3-methyl-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-methyl-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3290505 |
| Molecular Formula | C15H14N6O2S3 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 3-methyl-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(SCC(=O)Nc3nnc(C)s3)s2)c1 |
| InChI | InChI=1S/C15H14N6O2S3/c1-8-4-3-5-10(6-8)12(23)17-14-20-21-15(26-14)24-7-11(22)16-13-19-18-9(2)25-13/h3-6H,7H2,1-2H3,(H,16,19,22)(H,17,20,23) |
| InChIKey | OQORXMYPBAVSIJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|