C15H13BrN6O2S4 — CID 23857070
3-bromo-N-[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 23857070) has the molecular formula C15H13BrN6O2S4 and a molecular weight of 517.48 g/mol. Its IUPAC name is 3-bromo-N-[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-bromo-N-[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 23857070 |
| Molecular Formula | C15H13BrN6O2S4 |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 515.92 |
| IUPAC Name | 3-bromo-N-[5-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nnc(NC(=O)c3cccc(Br)c3)s2)s1 |
| InChI | InChI=1S/C15H13BrN6O2S4/c1-2-25-14-21-19-12(27-14)17-10(23)7-26-15-22-20-13(28-15)18-11(24)8-4-3-5-9(16)6-8/h3-6H,2,7H2,1H3,(H,17,19,23)(H,18,20,24) |
| InChIKey | IZAUAVBNHIKEKD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|