C17H11BrF2N4O2S2 — CID 40832931
3-bromo-N-[5-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 40832931) has the molecular formula C17H11BrF2N4O2S2 and a molecular weight of 485.34 g/mol. Its IUPAC name is 3-bromo-N-[5-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-bromo-N-[5-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 40832931 |
| Molecular Formula | C17H11BrF2N4O2S2 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | 3-bromo-N-[5-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cccc(Br)c2)s1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H11BrF2N4O2S2/c18-10-3-1-2-9(6-10)15(26)22-16-23-24-17(28-16)27-8-14(25)21-13-5-4-11(19)7-12(13)20/h1-7H,8H2,(H,21,25)(H,22,23,26) |
| InChIKey | ZOBJJBKMCKWNDP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|