C19H17F2N5O4S3 — CID 40833626
N-[5-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 40833626) has the molecular formula C19H17F2N5O4S3 and a molecular weight of 513.57 g/mol. Its IUPAC name is N-[5-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[5-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 40833626 |
| Molecular Formula | C19H17F2N5O4S3 |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | N-[5-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2nnc(SCC(=O)Nc3ccc(F)cc3F)s2)cc1 |
| InChI | InChI=1S/C19H17F2N5O4S3/c1-26(2)33(29,30)13-6-3-11(4-7-13)17(28)23-18-24-25-19(32-18)31-10-16(27)22-15-8-5-12(20)9-14(15)21/h3-9H,10H2,1-2H3,(H,22,27)(H,23,24,28) |
| InChIKey | UMACRWCDEBXVDZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|