C23H26FN5O4S3 — CID 23964474
4-(dipropylsulfamoyl)-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 23964474) has the molecular formula C23H26FN5O4S3 and a molecular weight of 551.69 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-(dipropylsulfamoyl)-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 23964474 |
| Molecular Formula | C23H26FN5O4S3 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | 4-(dipropylsulfamoyl)-N-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2nnc(SCC(=O)Nc3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C23H26FN5O4S3/c1-3-13-29(14-4-2)36(32,33)19-11-5-16(6-12-19)21(31)26-22-27-28-23(35-22)34-15-20(30)25-18-9-7-17(24)8-10-18/h5-12H,3-4,13-15H2,1-2H3,(H,25,30)(H,26,27,31) |
| InChIKey | HREKMCRJYZKITO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|