C19H17FN6O3S2 — CID 16823373
N-(4-acetamidophenyl)-2-[[5-[(4-fluorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 16823373) has the molecular formula C19H17FN6O3S2 and a molecular weight of 460.52 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[[5-[(4-fluorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[[5-[(4-fluorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16823373 |
| Molecular Formula | C19H17FN6O3S2 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[[5-[(4-fluorophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2nnc(NC(=O)Nc3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C19H17FN6O3S2/c1-11(27)21-13-6-8-14(9-7-13)22-16(28)10-30-19-26-25-18(31-19)24-17(29)23-15-4-2-12(20)3-5-15/h2-9H,10H2,1H3,(H,21,27)(H,22,28)(H2,23,24,25,29) |
| InChIKey | NXKQULXYKSKHQZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|