C19H16FN5O3S2 — CID 42448591
N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide (PubChem CID 42448591) has the molecular formula C19H16FN5O3S2 and a molecular weight of 445.50 g/mol. Its IUPAC name is N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide.
| Compound Name | N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 42448591 |
| Molecular Formula | C19H16FN5O3S2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2nnc(NC(=O)c3ccccc3F)s2)cc1 |
| InChI | InChI=1S/C19H16FN5O3S2/c1-11(26)21-12-6-8-13(9-7-12)22-16(27)10-29-19-25-24-18(30-19)23-17(28)14-4-2-3-5-15(14)20/h2-9H,10H2,1H3,(H,21,26)(H,22,27)(H,23,24,28) |
| InChIKey | XOVPOACJCSMJQT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|