C19H17FN4O2S2 — CID 43814560
N-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide (PubChem CID 43814560) has the molecular formula C19H17FN4O2S2 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide.
| Compound Name | N-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 43814560 |
| Molecular Formula | C19H17FN4O2S2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[5-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)CSc1nnc(NC(=O)c2ccccc2F)s1 |
| InChI | InChI=1S/C19H17FN4O2S2/c1-11-6-5-7-12(2)16(11)21-15(25)10-27-19-24-23-18(28-19)22-17(26)13-8-3-4-9-14(13)20/h3-9H,10H2,1-2H3,(H,21,25)(H,22,23,26) |
| InChIKey | HNRCZAIRQVNGQB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|