C14H16N4O2S2 — CID 2175403
2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 2175403) has the molecular formula C14H16N4O2S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2175403 |
| Molecular Formula | C14H16N4O2S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | CC(=O)Nc1nnc(SCC(=O)Nc2c(C)cccc2C)s1 |
| InChI | InChI=1S/C14H16N4O2S2/c1-8-5-4-6-9(2)12(8)16-11(20)7-21-14-18-17-13(22-14)15-10(3)19/h4-6H,7H2,1-3H3,(H,16,20)(H,15,17,19) |
| InChIKey | ILPFHXKBEHIGSI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|