C13H15N5O3S2 — CID 40682580
2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methyl-6-nitrophenyl)acetamide (PubChem CID 40682580) has the molecular formula C13H15N5O3S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methyl-6-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methyl-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 40682580 |
| Molecular Formula | C13H15N5O3S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methyl-6-nitrophenyl)acetamide |
| SMILES | CCNc1nnc(SCC(=O)Nc2c(C)cccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H15N5O3S2/c1-3-14-12-16-17-13(23-12)22-7-10(19)15-11-8(2)5-4-6-9(11)18(20)21/h4-6H,3,7H2,1-2H3,(H,14,16)(H,15,19) |
| InChIKey | VIOPMMOEVKPLNP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|