C18H16ClN5O3S2 — CID 23878440
N-(5-chloro-2-nitrophenyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 23878440) has the molecular formula C18H16ClN5O3S2 and a molecular weight of 449.95 g/mol. Its IUPAC name is N-(5-chloro-2-nitrophenyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-nitrophenyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 23878440 |
| Molecular Formula | C18H16ClN5O3S2 |
| Molecular Weight | 449.95 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | N-(5-chloro-2-nitrophenyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cccc(Nc2nnc(SCC(=O)Nc3cc(Cl)ccc3[N+](=O)[O-])s2)c1C |
| InChI | InChI=1S/C18H16ClN5O3S2/c1-10-4-3-5-13(11(10)2)21-17-22-23-18(29-17)28-9-16(25)20-14-8-12(19)6-7-15(14)24(26)27/h3-8H,9H2,1-2H3,(H,20,25)(H,21,22) |
| InChIKey | BJCIVPPVVFNKGA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|