C17H14ClN5O3S2 — CID 23883758
N-(5-chloro-2-nitrophenyl)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 23883758) has the molecular formula C17H14ClN5O3S2 and a molecular weight of 435.92 g/mol. Its IUPAC name is N-(5-chloro-2-nitrophenyl)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-nitrophenyl)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 23883758 |
| Molecular Formula | C17H14ClN5O3S2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | N-(5-chloro-2-nitrophenyl)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(Nc2nnc(SCC(=O)Nc3cc(Cl)ccc3[N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C17H14ClN5O3S2/c1-10-2-5-12(6-3-10)19-16-21-22-17(28-16)27-9-15(24)20-13-8-11(18)4-7-14(13)23(25)26/h2-8H,9H2,1H3,(H,19,21)(H,20,24) |
| InChIKey | OAXMJPUSZAMZAW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|