C18H14N6O3S2 — CID 3438366
N-(2-cyano-4-nitrophenyl)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 3438366) has the molecular formula C18H14N6O3S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3438366 |
| Molecular Formula | C18H14N6O3S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-2-[[5-(4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(Nc2nnc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3C#N)s2)cc1 |
| InChI | InChI=1S/C18H14N6O3S2/c1-11-2-4-13(5-3-11)20-17-22-23-18(29-17)28-10-16(25)21-15-7-6-14(24(26)27)8-12(15)9-19/h2-8H,10H2,1H3,(H,20,22)(H,21,25) |
| InChIKey | WKXDQCBDRVDHET-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|