C19H16N6O3S2 — CID 23905828
N-(2-cyano-4-nitrophenyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 23905828) has the molecular formula C19H16N6O3S2 and a molecular weight of 440.51 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 23905828 |
| Molecular Formula | C19H16N6O3S2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cccc(Nc2nnc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3C#N)s2)c1C |
| InChI | InChI=1S/C19H16N6O3S2/c1-11-4-3-5-15(12(11)2)22-18-23-24-19(30-18)29-10-17(26)21-16-7-6-14(25(27)28)8-13(16)9-20/h3-8H,10H2,1-2H3,(H,21,26)(H,22,23) |
| InChIKey | LKSQLQIBSVOENX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|