C17H16ClN5OS2 — CID 5026417
N-(2-chloro-3-pyridinyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 5026417) has the molecular formula C17H16ClN5OS2 and a molecular weight of 405.94 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5026417 |
| Molecular Formula | C17H16ClN5OS2 |
| Molecular Weight | 405.94 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cccc(Nc2nnc(SCC(=O)Nc3cccnc3Cl)s2)c1C |
| InChI | InChI=1S/C17H16ClN5OS2/c1-10-5-3-6-12(11(10)2)21-16-22-23-17(26-16)25-9-14(24)20-13-7-4-8-19-15(13)18/h3-8H,9H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | OXOSRHVPPXRNOY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|