C19H20ClN5OS2 — CID 24519541
N-(2-chloro-3-pyridinyl)-2-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 24519541) has the molecular formula C19H20ClN5OS2 and a molecular weight of 433.99 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 24519541 |
| Molecular Formula | C19H20ClN5OS2 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCc1cccc(CC)c1Nc1nnc(SCC(=O)Nc2cccnc2Cl)s1 |
| InChI | InChI=1S/C19H20ClN5OS2/c1-3-12-7-5-8-13(4-2)16(12)23-18-24-25-19(28-18)27-11-15(26)22-14-9-6-10-21-17(14)20/h5-10H,3-4,11H2,1-2H3,(H,22,26)(H,23,24) |
| InChIKey | VICWUWNLOKVMJA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|