C16H14ClN5OS2 — CID 4851382
N-(2-chloro-3-pyridinyl)-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4851382) has the molecular formula C16H14ClN5OS2 and a molecular weight of 391.91 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4851382 |
| Molecular Formula | C16H14ClN5OS2 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cccc(Nc2nnc(SCC(=O)Nc3cccnc3Cl)s2)c1 |
| InChI | InChI=1S/C16H14ClN5OS2/c1-10-4-2-5-11(8-10)19-15-21-22-16(25-15)24-9-13(23)20-12-6-3-7-18-14(12)17/h2-8H,9H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | NSPSNBNOJHUNRE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|