C18H22N4O2S2 — CID 3220484
N-[5-[2-(2,6-diethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide (PubChem CID 3220484) has the molecular formula C18H22N4O2S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[5-[2-(2,6-diethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[2-(2,6-diethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 3220484 |
| Molecular Formula | C18H22N4O2S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[5-[2-(2,6-diethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CSc1nnc(NC(=O)C2CC2)s1 |
| InChI | InChI=1S/C18H22N4O2S2/c1-3-11-6-5-7-12(4-2)15(11)19-14(23)10-25-18-22-21-17(26-18)20-16(24)13-8-9-13/h5-7,13H,3-4,8-10H2,1-2H3,(H,19,23)(H,20,21,24) |
| InChIKey | CCDPWZAFCQOLAK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|