C22H30N4O3S2 — CID 40833312
4-butyl-N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxamide (PubChem CID 40833312) has the molecular formula C22H30N4O3S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 4-butyl-N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 40833312 |
| Molecular Formula | C22H30N4O3S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 4-butyl-N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2nnc(SCC(=O)Nc3cccc(OC)c3)s2)CC1 |
| InChI | InChI=1S/C22H30N4O3S2/c1-3-4-6-15-9-11-16(12-10-15)20(28)24-21-25-26-22(31-21)30-14-19(27)23-17-7-5-8-18(13-17)29-2/h5,7-8,13,15-16H,3-4,6,9-12,14H2,1-2H3,(H,23,27)(H,24,25,28) |
| InChIKey | OYGWQUIQVNZNRB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|