C22H27F3N4O2S2 — CID 44956893
4-butyl-N-[5-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxamide (PubChem CID 44956893) has the molecular formula C22H27F3N4O2S2 and a molecular weight of 500.61 g/mol. Its IUPAC name is 4-butyl-N-[5-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-[5-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 44956893 |
| Molecular Formula | C22H27F3N4O2S2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 4-butyl-N-[5-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2nnc(SCC(=O)Nc3ccc(C(F)(F)F)cc3)s2)CC1 |
| InChI | InChI=1S/C22H27F3N4O2S2/c1-2-3-4-14-5-7-15(8-6-14)19(31)27-20-28-29-21(33-20)32-13-18(30)26-17-11-9-16(10-12-17)22(23,24)25/h9-12,14-15H,2-8,13H2,1H3,(H,26,30)(H,27,28,31) |
| InChIKey | SOZGAHRUHUAEOC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|