C15H16ClF3N4OS2 — CID 2553208
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 2553208) has the molecular formula C15H16ClF3N4OS2 and a molecular weight of 424.90 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2553208 |
| Molecular Formula | C15H16ClF3N4OS2 |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCNc1nnc(SCC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C15H16ClF3N4OS2/c1-2-3-6-20-13-22-23-14(26-13)25-8-12(24)21-9-4-5-11(16)10(7-9)15(17,18)19/h4-5,7H,2-3,6,8H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | QYOJPNDDTUNHQX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|