C17H25N5O3S3 — CID 16500061
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide (PubChem CID 16500061) has the molecular formula C17H25N5O3S3 and a molecular weight of 443.62 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 16500061 |
| Molecular Formula | C17H25N5O3S3 |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methylphenyl]acetamide |
| SMILES | CCCCNc1nnc(SCC(=O)Nc2ccc(C)c(S(=O)(=O)N(C)C)c2)s1 |
| InChI | InChI=1S/C17H25N5O3S3/c1-5-6-9-18-16-20-21-17(27-16)26-11-15(23)19-13-8-7-12(2)14(10-13)28(24,25)22(3)4/h7-8,10H,5-6,9,11H2,1-4H3,(H,18,20)(H,19,23) |
| InChIKey | JJGNKMOLAPYRFI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|