C16H21N3OS2 — CID 24523549
2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dimethylphenyl)ethanone (PubChem CID 24523549) has the molecular formula C16H21N3OS2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dimethylphenyl)ethanone.
| Compound Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 24523549 |
| Molecular Formula | C16H21N3OS2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dimethylphenyl)ethanone |
| SMILES | CCCCNc1nnc(SCC(=O)c2ccc(C)c(C)c2)s1 |
| InChI | InChI=1S/C16H21N3OS2/c1-4-5-8-17-15-18-19-16(22-15)21-10-14(20)13-7-6-11(2)12(3)9-13/h6-7,9H,4-5,8,10H2,1-3H3,(H,17,18) |
| InChIKey | XDXAZHWZUMTFQU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|